StemCET Logo

Chemistry Question 135 – AP-EAMCET 2025

Consider the following Statement-I : The products formed when diborane burns in air are B2O3, H2 and O2. Statement-II : Hybridization of boron atom in orthoboric acid is sp2. The correct answer is

Understand the typical products formed when a hydride like diborane burns in air. Combustion reactions usually involve oxygen and produce oxides and water.

Step 1: Analyze Statement-I (Combustion of Diborane)✦ Active

Diborane (B2H6) is a hydride of boron. When it burns in air (reacts with oxygen, O2), it undergoes a combustion reaction. The typical products of combustion for compounds containing boron and hydrogen are boron oxide and water.

B2H6(g)+3O2(g)B2O3(s)+3H2O(g)

The statement claims the products are B2O3, H2, and O2. This is incorrect as water (H2O) is formed, not hydrogen gas (H2), and oxygen (O2) is a reactant, not a product. Therefore, Statement-I is incorrect.

💡 Teacher's Secret Hint

Remember that combustion reactions involving hydrogen-containing compounds typically produce water, not elemental hydrogen.

Step 2: Analyze Statement-II (Hybridization of Boron in Orthoboric Acid)○ Expand

Orthoboric acid has the chemical formula H3BO3. The central atom is boron (B). Boron is bonded to three hydroxyl (-OH) groups.

To determine the hybridization, we count the number of sigma bonds and lone pairs around the central boron atom. In H3BO3, boron forms three single bonds with three oxygen atoms (from the -OH groups) and has no lone pairs.

Steric Number=(Number of sigma bonds)+(Number of lone pairs) Steric Number for B in H3BO3=3+0=3

A steric number of 3 corresponds to sp2 hybridization and a trigonal planar geometry. Therefore, Statement-II is correct.

💡 Teacher's Secret Hint

For main group elements, the steric number directly correlates with hybridization: 2 = sp, 3 = sp2, 4 = sp3.

Step 3: Conclude based on Statement Analysis○ Expand

Statement-I is incorrect, and Statement-II is correct.

This matches option 4: "Statement-I is not correct, but statement-II is correct".

✦ STEM Console utilizes AI models to generate step-by-step explanations and math clues. AI can make mistakes.