StemCET Logo

Chemistry Question 128 – AP-EAMCET 2025

In acid medium dichromate oxidizes sulphite to sulphate as shown below: xCr2O72+ySO32+zH+aCr3++bSO42+cH2O Identify correct statements about this balanced equation (only) I) Sum of x and y is 4 II) Sum of a and c is equals to (3+b) III) Sum of x,y and z is 11

Identify the oxidation and reduction half-reactions in the given chemical equation.

Step 1: Identify Oxidation and Reduction Half-Reactions✦ Active

The given reaction involves dichromate (Cr2O72) being reduced to chromium(III) (Cr3+), and sulphite (SO32) being oxidized to sulphate (SO42). We need to balance these two half-reactions in an acidic medium.

Step 2: Balance the Oxidation Half-Reaction○ Expand

For the oxidation of sulphite to sulphate:

SO32SO42

Balance oxygen atoms by adding H2O:

SO32+H2OSO42

Balance hydrogen atoms by adding H+:

SO32+H2OSO42+2H+

Balance charge by adding electrons. The left side has a charge of 2, and the right side has a charge of 0. Add 2 electrons to the right side:

SO32+H2OSO42+2H++2e(Equation 1)
💡 Teacher's Secret Hint

Remember to add H2O to the side deficient in oxygen and H+ to the side deficient in hydrogen when balancing in acidic medium.

Step 3: Balance the Reduction Half-Reaction○ Expand

For the reduction of dichromate to chromium(III):

Cr2O72Cr3+

Balance chromium atoms:

Cr2O722Cr3+

Balance oxygen atoms by adding H2O:

Cr2O722Cr3++7H2O

Balance hydrogen atoms by adding H+:

Cr2O72+14H+2Cr3++7H2O

Balance charge by adding electrons. The left side has a charge of (2+14)=+12, and the right side has a charge of 2(+3)=+6. Add 6 electrons to the left side:

Cr2O72+14H++6e2Cr3++7H2O(Equation 2)
Step 4: Combine Half-Reactions and Determine Coefficients○ Expand

To combine the half-reactions, the number of electrons must be equal. Multiply Equation 1 by 3 to get 6 electrons:

3(SO32+H2OSO42+2H++2e) 3SO32+3H2O3SO42+6H++6e(Equation 1')

Now, add Equation 1' and Equation 2:

(Cr2O72+14H++6e)+(3SO32+3H2O)(2Cr3++7H2O)+(3SO42+6H++6e)

Cancel electrons and simplify H+ and H2O on both sides:

Cr2O72+(146)H++3SO322Cr3++(73)H2O+3SO42 Cr2O72+3SO32+8H+2Cr3++3SO42+4H2O

Comparing this with the given equation xCr2O72+ySO32+zH+aCr3++bSO42+cH2O, we find the coefficients: x=1 y=3 z=8 a=2 b=3 c=4

💡 Teacher's Secret Hint

Always double-check the final balanced equation for atom and charge balance.

Step 5: Evaluate the Statements○ Expand

Now, let's check each statement: I) Sum of x and y is 4: x+y=1+3=4. This statement is **True**. II) Sum of a and c is equals to (3+b): a+c=2+4=6. 3+b=3+3=6. Since 6=6, this statement is **True**. III) Sum of x,y and z is 11: x+y+z=1+3+8=12. Since 1211, this statement is **False**.

Therefore, only statements I and II are correct.

💡 Teacher's Secret Hint

Carefully substitute the derived coefficients into each statement to avoid calculation errors.

✦ STEM Console utilizes AI models to generate step-by-step explanations and math clues. AI can make mistakes.