StemCET Logo

Chemistry Question 71 – JEE-MAIN 2026

← Back
If 3.365g of ethanol (l) is burnt completely in a bomb calorimeter at 298.15 K, the heat produced is 99.472 kJ. The |ΔHf| of ethanol at 298.15 K is _______ ×102 kJ mol1. (Nearest integer) Given: Standard enthalpy for combustion of graphite = 393.5 kJ mol1 Standard enthalpy of formation of water (l) = 285.8 kJ mol1 Molar mass in g mol1 of C, H, O are 12, 1 and 16 respectively

First, determine the moles of ethanol combusted and the molar enthalpy of combustion.

Video Walkthrough
Step 1: Calculate Molar Mass and Moles of Ethanol✦ Active

The molar mass of ethanol (C2H5OH) is calculated from the atomic masses of C (12), H (1), and O (16):

M=(2×12)+(6×1)+(1×16)=24+6+16=46 g/mol

Moles of ethanol burnt can then be determined from the given mass:

n=3.365 g46 g/mol=0.073152 mol
Step 2: Determine Molar Enthalpy of Combustion○ Expand

The heat produced is 99.472 kJ. Since heat is produced (exothermic reaction), the enthalpy change for combustion is negative. The molar enthalpy of combustion (ΔHc) is:

ΔHc=99.472 kJ0.073152 mol=1359.89 kJ/mol
💡 Teacher's Secret Hint

Remember that heat produced implies a negative enthalpy change for the system.

Step 3: Apply Hess's Law to find Enthalpy of Formation○ Expand

The balanced combustion reaction for ethanol is:

C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l)

Using Hess's Law, the enthalpy of combustion is related to the standard enthalpies of formation of products and reactants:

ΔHc=[2ΔHf(CO2)+3ΔHf(H2O)][ΔHf(C2H5OH)+3ΔHf(O2)]

Given ΔHf(CO2)=393.5 kJ/mol (standard enthalpy of combustion of graphite) and ΔHf(H2O)=285.8 kJ/mol. The standard enthalpy of formation of O2(g) is 0 kJ/mol. Substituting the values:

1359.89=[2(393.5)+3(285.8)][ΔHf(C2H5OH)+3(0)]
1359.89=[787.0857.4]ΔHf(C2H5OH)
1359.89=1644.4ΔHf(C2H5OH)
ΔHf(C2H5OH)=1644.4+1359.89=284.51 kJ/mol

The absolute value is |ΔHf(C2H5OH)|=284.51 kJ/mol. To express this in the format ×102 kJ mol1:

284.51=X×102X=284.51100=2.8451

Rounding to the nearest integer, X=3.

💡 Teacher's Secret Hint

Ensure correct signs for enthalpy changes and remember that elements in their standard states have zero enthalpy of formation.

✦ STEM Console utilizes AI models to generate step-by-step explanations and math clues. AI can make mistakes.